Record Information |
---|
HMDB Status | Not Available |
---|
Creation Date | 2024-02-21 14:52:50 UTC |
---|
Update Date | 2025-03-25 00:51:07 UTC |
---|
HMDB ID | Not Available |
---|
Metabolite Identification |
---|
DeepMet ID | DMID02184911 |
---|
Frequency | 0.5 |
---|
Structure | |
---|
Chemical Formula | C10H19N3O8 |
---|
Molecular Mass | 309.1172 |
---|
SMILES | N=C(N)NC1CC(O)(C(=O)O)OC(C(O)C(O)CO)C1O |
---|
InChI Key | GULCQOAKPLLGLW-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | organic oxygen compounds |
---|
Class | organooxygen compounds |
---|
Subclass | carbohydrates and carbohydrate conjugates |
---|
Direct Parent | c-glucuronides |
---|
Geometric Descriptor | aliphatic heteromonocyclic compounds |
---|
Alternative Parents | alpha hydroxy acids and derivativescarbonyl compoundscarboximidamidescarboxylic acidsgamma amino acids and derivativesguanidineshemiacetalshydrocarbon derivativesiminesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesorganopnictogen compoundsoxacyclic compoundsoxanesprimary alcoholspyran carboxylic acidssecondary alcohols |
---|
Substituents | carbonyl groupcarboxylic acidgamma amino acid or derivativesguanidineiminealpha-hydroxy acidmonosaccharidecarboxylic acid derivativepyran carboxylic acidorganic oxidealiphatic heteromonocyclic compoundorganonitrogen compoundorganopnictogen compoundhemiacetaloxaneprimary alcoholorganoheterocyclic compoundc-glucuronidealcoholpyran carboxylic acid or derivativescarboximidamidehydroxy acidoxacyclemonocarboxylic acid or derivativespyransecondary alcoholhydrocarbon derivativeorganic nitrogen compound |
---|