| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:52:51 UTC |
|---|
| Update Date | 2025-03-25 00:51:08 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02184968 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H8Cl2N2O |
|---|
| Molecular Mass | 314.0014 |
|---|
| SMILES | N#Cc1cnc2ccccc2c1Oc1ccc(Cl)cc1Cl |
|---|
| InChI Key | VJJJFAGYKGJXHO-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | ethers |
|---|
| Direct Parent | diarylethers |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 2-halopyridinesaryl chloridesazacyclic compoundschloroquinolinesdichlorobenzenesheteroaromatic compoundshydrocarbon derivativesnitrilesorganochloridesorganonitrogen compoundsorganopnictogen compoundsphenol ethersphenoxy compoundspolyhalopyridinespyridines and derivativesquinolines and derivatives |
|---|
| Substituents | diaryl etherphenol ethermonocyclic benzene moietynitrilepolyhalopyridineorganochlorideorganohalogen compound1,3-dichlorobenzenearomatic heteropolycyclic compoundorganonitrogen compoundquinolineorganopnictogen compound2-halopyridinecarbonitrileorganoheterocyclic compoundaryl chloridechlorobenzeneazacycleheteroaromatic compoundaryl halidepyridinechloroquinolinehydrocarbon derivativebenzenoidorganic nitrogen compoundhalobenzenephenoxy compound |
|---|
