| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:52:52 UTC |
|---|
| Update Date | 2025-03-25 00:51:08 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02184983 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H17N5O4 |
|---|
| Molecular Mass | 259.1281 |
|---|
| SMILES | N=C(N)NC(=N)NC1CCC(O)(C(=O)O)CC1O |
|---|
| InChI Key | NDNWODDTNNYTFR-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | delta amino acids and derivatives |
|---|
| Geometric Descriptor | aliphatic homomonocyclic compounds |
|---|
| Alternative Parents | alpha hydroxy acids and derivativesbiguanidescarbonyl compoundscarboximidamidescarboxylic acidscyclic alcohols and derivativescyclohexanolshydrocarbon derivativesiminesmonocarboxylic acids and derivativesorganic oxidesorganopnictogen compoundstertiary alcohols |
|---|
| Substituents | carbonyl groupcarboxylic acidguanidineiminealpha-hydroxy acidorganic oxideorganonitrogen compoundorganopnictogen compounddelta amino acid or derivativesalcoholcyclohexanolcarboximidamidehydroxy acidcyclic alcoholtertiary alcoholmonocarboxylic acid or derivativesorganic oxygen compoundsecondary alcoholaliphatic homomonocyclic compoundhydrocarbon derivativeorganic nitrogen compoundbiguanideorganooxygen compound |
|---|
