| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:52:52 UTC |
|---|
| Update Date | 2025-03-25 00:51:08 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02184984 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H11N5O3 |
|---|
| Molecular Mass | 237.0862 |
|---|
| SMILES | N=C(N)NC(=N)Nc1cc(C(=O)O)ccc1O |
|---|
| InChI Key | HYAFYCFZRJGCOS-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzoic acids and derivatives |
|---|
| Direct Parent | guanidinobenzoic acids and derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-arylbiguanides1-hydroxy-2-unsubstituted benzenoidsbenzoic acidsbenzoyl derivativescarboximidamidescarboxylic acidshydrocarbon derivativeshydroxybenzoic acid derivativesiminesmonocarboxylic acids and derivativesorganic oxidesorganooxygen compoundsorganopnictogen compounds |
|---|
| Substituents | carboxylic acidguanidineiminebenzoyl1-hydroxy-2-unsubstituted benzenoidcarboxylic acid derivativeorganic oxideorganonitrogen compoundorganopnictogen compound1-arylbiguanidebenzoic acidcarboximidamidehydroxybenzoic acidaromatic homomonocyclic compoundarylbiguanidemonocarboxylic acid or derivativesorganic oxygen compoundphenolhydrocarbon derivativeguanidinobenzoic acid or derivativesorganic nitrogen compoundbiguanideorganooxygen compound |
|---|