| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:52:53 UTC |
|---|
| Update Date | 2025-03-25 00:51:08 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02185030 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H25N7O |
|---|
| Molecular Mass | 319.2121 |
|---|
| SMILES | N=C(N)NCCCCCCNC(=N)NC(=O)Nc1ccccc1 |
|---|
| InChI Key | SZRJUXRSUWSHHL-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | n-phenylureas |
|---|
| Direct Parent | n-phenylureas |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | carbonyl compoundscarboximidamidesguanidineshydrocarbon derivativesiminesorganic carbonic acids and derivativesorganic oxidesorganopnictogen compounds |
|---|
| Substituents | carbonyl groupcarbonic acid derivativeguanidineiminecarboximidamidearomatic homomonocyclic compoundn-phenylureaorganic oxideorganic oxygen compoundorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|