| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:52:54 UTC |
|---|
| Update Date | 2025-03-25 00:51:09 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02185089 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C6H13N3O5S2 |
|---|
| Molecular Mass | 271.0297 |
|---|
| SMILES | NC(=O)CCNC(=O)C(N)CSS(=O)(=O)O |
|---|
| InChI Key | MPSSMOQDGMGMCV-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | peptidomimetics |
|---|
| Subclass | hybrid peptides |
|---|
| Direct Parent | hybrid peptides |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | alpha amino acid amidesalpha amino acidsbeta amino acids and derivativescarbonyl compoundscarboxylic acids and derivativescysteine and derivativeshydrocarbon derivativesmonoalkylaminesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsprimary carboxylic acid amidess-alkyl thiosulfatessecondary carboxylic acid amidessulfenyl compounds |
|---|
| Substituents | primary carboxylic acid amidealiphatic acyclic compoundcarbonyl groupsulfenyl compoundalpha-amino acid amidealpha-amino acid or derivativesorganosulfur compoundcarboxamide groupcarboxylic acid derivativebeta amino acid or derivativess-alkyl thiosulfatesecondary carboxylic acid amideorganic oxideorganic oxygen compoundcysteine or derivativesorganonitrogen compoundalpha-amino acidhybrid peptideorganopnictogen compoundhydrocarbon derivativeprimary aliphatic amineorganic nitrogen compoundorganooxygen compound |
|---|
