| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:52:55 UTC |
|---|
| Update Date | 2025-03-25 00:51:09 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02185097 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C6H13N2O7P |
|---|
| Molecular Mass | 256.046 |
|---|
| SMILES | NC(=O)N1CC(O)C(O)C1COP(=O)(O)O |
|---|
| InChI Key | OIPBHCWZCLJFDH-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pyrrolidines |
|---|
| Subclass | pyrrolidine carboxylic acids and derivatives |
|---|
| Direct Parent | pyrrolidinecarboxamides |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,2-diolsazacyclic compoundscarbonyl compoundshydrocarbon derivativesmonoalkyl phosphatesorganic carbonic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundssecondary alcohols |
|---|
| Substituents | alcoholcarbonyl groupcarbonic acid derivativeazacycleorganic oxideorganic oxygen compoundphosphoric acid estermonoalkyl phosphatealiphatic heteromonocyclic compoundorganonitrogen compoundsecondary alcoholorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundorganic phosphoric acid derivativealkyl phosphateorganooxygen compoundpyrrolidine-1-carboxamide1,2-diol |
|---|
