| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:52:55 UTC |
|---|
| Update Date | 2025-03-25 00:51:09 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02185106 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H20N2O4 |
|---|
| Molecular Mass | 304.1423 |
|---|
| SMILES | NC(=O)Cc1ccc(OCC(O)C(O)Cn2cccc2)cc1 |
|---|
| InChI Key | BFCZKLIWWYEABY-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | phenylacetamides |
|---|
| Direct Parent | phenylacetamides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,2-diolsalkyl aryl ethersazacyclic compoundscarbonyl compoundscarboxylic acids and derivativesheteroaromatic compoundshydrocarbon derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsphenol ethersphenoxy compoundsprimary carboxylic acid amidessecondary alcoholssubstituted pyrroles |
|---|
| Substituents | primary carboxylic acid amidephenol ethercarbonyl groupetheraromatic heteromonocyclic compoundsubstituted pyrrolealkyl aryl ethercarboxylic acid derivativeorganic oxideorganonitrogen compoundorganopnictogen compoundphenylacetamideorganoheterocyclic compound1,2-diolalcoholazacycleheteroaromatic compoundcarboxamide grouporganic oxygen compoundpyrrolesecondary alcoholhydrocarbon derivativeorganic nitrogen compoundphenoxy compoundorganooxygen compound |
|---|
