| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:52:55 UTC |
|---|
| Update Date | 2025-03-25 00:51:10 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02185117 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H17N3O7S |
|---|
| Molecular Mass | 371.0787 |
|---|
| SMILES | NC(=O)CCC1NC(=O)C(Cc2cccc(OS(=O)(=O)O)c2)NC1=O |
|---|
| InChI Key | HPJMLFKOQZIHGR-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic sulfuric acids and derivatives |
|---|
| Subclass | arylsulfates |
|---|
| Direct Parent | phenylsulfates |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 2,5-dioxopiperazinesalpha amino acidsazacyclic compoundscarbonyl compoundscarboxylic acids and derivativesfatty amideshydrocarbon derivativeslactamsorganic oxidesorganonitrogen compoundsorganopnictogen compoundsphenoxy compoundsprimary carboxylic acid amidessecondary carboxylic acid amidessulfuric acid monoesters |
|---|
| Substituents | primary carboxylic acid amidefatty acylmonocyclic benzene moietysulfuric acid monoestercarbonyl grouplactamaromatic heteromonocyclic compoundfatty amidealpha-amino acid or derivatives2,5-dioxopiperazinecarboxylic acid derivativephenylsulfateorganic oxidedioxopiperazinepiperazineorganonitrogen compoundalpha-amino acidorganopnictogen compoundorganoheterocyclic compoundazacyclecarboxamide groupsecondary carboxylic acid amideorganic oxygen compound1,4-diazinanesulfate-esterhydrocarbon derivativebenzenoidorganic nitrogen compoundphenoxy compoundsulfuric acid esterorganooxygen compound |
|---|