Record Information |
---|
HMDB Status | Not Available |
---|
Creation Date | 2024-02-21 14:52:55 UTC |
---|
Update Date | 2025-03-25 00:51:10 UTC |
---|
HMDB ID | Not Available |
---|
Metabolite Identification |
---|
DeepMet ID | DMID02185133 |
---|
Frequency | 0.5 |
---|
Structure | |
---|
Chemical Formula | C17H18N2O5 |
---|
Molecular Mass | 330.1216 |
---|
SMILES | NC(=O)CCC(NC(=O)Cc1ccc(O)c2ccccc12)C(=O)O |
---|
InChI Key | AHVPIKGKGBPRSN-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | organic acids and derivatives |
---|
Class | carboxylic acids and derivatives |
---|
Subclass | amino acids, peptides, and analogues |
---|
Direct Parent | glutamine and derivatives |
---|
Geometric Descriptor | aromatic homopolycyclic compounds |
---|
Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsalpha amino acidscarbonyl compoundscarboxylic acidsfatty amideshydrocarbon derivativesmonocarboxylic acids and derivativesn-acyl-alpha amino acidsnaphthols and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsprimary carboxylic acid amidessecondary carboxylic acid amides |
---|
Substituents | primary carboxylic acid amidefatty acylcarbonyl groupcarboxylic acidglutamine or derivativesfatty amide1-hydroxy-2-unsubstituted benzenoidorganic oxideorganonitrogen compoundalpha-amino acidorganopnictogen compoundn-acyl-alpha amino acid or derivativesn-acyl-alpha-amino acidaromatic homopolycyclic compoundcarboxamide groupsecondary carboxylic acid amidemonocarboxylic acid or derivativesnaphthaleneorganic oxygen compoundhydrocarbon derivative1-naphtholbenzenoidorganic nitrogen compoundorganooxygen compound |
---|