| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:52:56 UTC |
|---|
| Update Date | 2025-03-25 00:51:10 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02185159 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H12N2O2S3 |
|---|
| Molecular Mass | 264.0061 |
|---|
| SMILES | NC(=O)CCC1SCC2SSC(=O)NC12 |
|---|
| InChI Key | WLJPADWAADSLRX-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | fatty acyls |
|---|
| Subclass | fatty amides |
|---|
| Direct Parent | fatty amides |
|---|
| Geometric Descriptor | aliphatic heteropolycyclic compounds |
|---|
| Alternative Parents | carbonyl compoundscarboxylic acids and derivativesdialkylthioethersdithiazinaneshydrocarbon derivativesorganic carbonic acids and derivativesorganic disulfidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsprimary carboxylic acid amidesthiolactonesthiolanes |
|---|
| Substituents | thiolaneprimary carboxylic acid amidecarbonyl groupdithiazinanecarbonic acid derivativeazacycledialkylthioetherfatty amidecarboxamide groupcarboxylic acid derivativealiphatic heteropolycyclic compoundorganic oxideorganic oxygen compoundthioetherorganic disulfideorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundthiolactoneorganoheterocyclic compoundorganooxygen compound |
|---|
