Record Information |
---|
HMDB Status | Not Available |
---|
Creation Date | 2024-02-21 14:52:56 UTC |
---|
Update Date | 2025-03-25 00:51:10 UTC |
---|
HMDB ID | Not Available |
---|
Metabolite Identification |
---|
DeepMet ID | DMID02185168 |
---|
Frequency | 0.5 |
---|
Structure | |
---|
Chemical Formula | C11H15NO3 |
---|
Molecular Mass | 209.1052 |
---|
SMILES | NC(=O)c1ccc(C2CCC(O)CC2)o1 |
---|
InChI Key | HEVZEPGQEYYJAI-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | organoheterocyclic compounds |
---|
Class | furans |
---|
Subclass | furoic acid and derivatives |
---|
Direct Parent | furoic acid and derivatives |
---|
Geometric Descriptor | aromatic heteromonocyclic compounds |
---|
Alternative Parents | 2-heteroaryl carboxamidescarboxylic acids and derivativescyclic alcohols and derivativescyclohexanolsheteroaromatic compoundshydrocarbon derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsprimary carboxylic acid amides |
---|
Substituents | primary carboxylic acid amidealcoholfuroic acid or derivativesaromatic heteromonocyclic compoundheteroaromatic compoundcyclohexanolcyclic alcoholcarboxamide groupcarboxylic acid derivative2-heteroaryl carboxamideoxacycleorganic oxideorganic oxygen compoundorganonitrogen compoundsecondary alcoholorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
---|