| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:52:57 UTC |
|---|
| Update Date | 2025-03-25 00:51:10 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02185178 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H7F3N2O |
|---|
| Molecular Mass | 204.051 |
|---|
| SMILES | NC(=O)c1ccc(N)c(C(F)(F)F)c1 |
|---|
| InChI Key | SUWDOVJGNGNMKM-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | trifluoromethylbenzenes |
|---|
| Direct Parent | trifluoromethylbenzenes |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alkyl fluoridesamino acids and derivativesbenzamidesbenzoyl derivativescarboxylic acids and derivativeshydrocarbon derivativesorganic oxidesorganofluoridesorganooxygen compoundsorganopnictogen compoundsprimary aminesprimary carboxylic acid amides |
|---|
| Substituents | primary carboxylic acid amideamino acid or derivativesbenzoylcarboxylic acid derivativeorganohalogen compoundbenzamideorganic oxideorganonitrogen compoundorganopnictogen compoundalkyl halidetrifluoromethylbenzenealkyl fluorideorganofluoridebenzoic acid or derivativescarboxamide grouparomatic homomonocyclic compoundorganic oxygen compoundhydrocarbon derivativeprimary amineorganic nitrogen compoundamineorganooxygen compound |
|---|
