| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:52:59 UTC |
|---|
| Update Date | 2025-03-25 00:51:10 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02185258 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C22H25N3O3 |
|---|
| Molecular Mass | 379.1896 |
|---|
| SMILES | NC(=O)C(Cc1ccccc1)NC(Cc1ccccc1)C(=O)C1CCC(=O)N1 |
|---|
| InChI Key | CPCQHFSLIICRSP-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | phenylalanine and derivatives |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | alpha amino acidsamphetamines and derivativesazacyclic compoundsbenzene and substituted derivativescarboxylic acids and derivativesdialkylaminesfatty amideshydrocarbon derivativesketoneslactamsorganic oxidesorganopnictogen compoundsprimary carboxylic acid amidespyrrolidine-2-onessecondary carboxylic acid amides |
|---|
| Substituents | primary carboxylic acid amidefatty acyl2-pyrrolidonemonocyclic benzene moietycarbonyl grouplactamaromatic heteromonocyclic compoundfatty amideketoneorganic oxideorganonitrogen compoundalpha-amino acidorganopnictogen compoundpyrrolidinepyrrolidoneorganoheterocyclic compoundamphetamine or derivativessecondary aliphatic amineazacyclesecondary aminecarboxamide groupsecondary carboxylic acid amidephenylalanine or derivativesorganic oxygen compoundhydrocarbon derivativebenzenoidorganic nitrogen compoundorganooxygen compoundamine |
|---|
