| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:53:05 UTC |
|---|
| Update Date | 2025-03-25 00:51:13 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02185484 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H10N6O5 |
|---|
| Molecular Mass | 282.0713 |
|---|
| SMILES | Nc1nc2nc(N)c(C(O)C(O)C(=O)O)nc2c(=O)[nH]1 |
|---|
| InChI Key | JEDGPADYOWLUNQ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pteridines and derivatives |
|---|
| Subclass | pterins and derivatives |
|---|
| Direct Parent | pterins and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1,2-diolsalpha hydroxy acids and derivativesamino acidsaromatic alcoholsazacyclic compoundsbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acidsheteroaromatic compoundshydrocarbon derivativesimidolactamslactamsmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesorganopnictogen compoundsprimary aminespyrazinespyrimidonessecondary alcohols |
|---|
| Substituents | aromatic alcoholcarbonyl grouplactamcarboxylic acidamino acid or derivativesamino acidalpha-hydroxy acidmonosaccharidepyrimidonecarboxylic acid derivativepyrimidinebeta-hydroxy acidsaccharideorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundimidolactam1,2-diolalcoholpterinazacycleheteroaromatic compoundhydroxy acidmonocarboxylic acid or derivativesorganic oxygen compoundpyrazinesecondary alcoholhydrocarbon derivativeprimary amineorganic nitrogen compoundamineorganooxygen compound |
|---|