| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:53:05 UTC |
|---|
| Update Date | 2025-03-25 00:51:13 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02185486 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H9N5O3 |
|---|
| Molecular Mass | 283.0705 |
|---|
| SMILES | Nc1nc2ncc(C(=O)c3ccc(O)cc3)nc2c(=O)[nH]1 |
|---|
| InChI Key | LVXFXINHBQIZGZ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbonyl compounds |
|---|
| Direct Parent | aryl-phenylketones |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsaryl ketonesazacyclic compoundsbenzoyl derivativesheteroaromatic compoundshydrocarbon derivativeslactamsorganic oxidesorganooxygen compoundsorganopnictogen compoundsprimary aminespterins and derivativespyrazine carboxylic acids and derivativespyrimidones |
|---|
| Substituents | monocyclic benzene moietylactambenzoyl1-hydroxy-2-unsubstituted benzenoidpyrimidonepteridinepyrimidineorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundorganoheterocyclic compoundpterinazacyclearyl-phenylketoneheteroaromatic compoundpyrazinephenolpyrazine carboxylic acid or derivativeshydrocarbon derivativebenzenoidprimary amineorganic nitrogen compoundamine |
|---|
