| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:53:05 UTC |
|---|
| Update Date | 2025-03-25 00:51:13 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02185491 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H17N6O8P |
|---|
| Molecular Mass | 416.0845 |
|---|
| SMILES | Nc1nc2nc3c(ccn3CC(O)C(O)C(O)COP(=O)(O)O)nc2c(=O)[nH]1 |
|---|
| InChI Key | SFDKKPZWRUYWMH-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pteridines and derivatives |
|---|
| Subclass | pterins and derivatives |
|---|
| Direct Parent | pterins and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsheteroaromatic compoundshydrocarbon derivativeslactamsmonoalkyl phosphatesorganic oxidesorganopnictogen compoundsprimary aminespyrazinespyrimidonespyrrolopyrazinessecondary alcoholssubstituted pyrroles |
|---|
| Substituents | lactampyrimidonesubstituted pyrrolepyrimidineorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundpyrrolopyrazinealcoholpterinazacycleheteroaromatic compoundorganic oxygen compoundphosphoric acid esterpyrazinemonoalkyl phosphatepyrrolesecondary alcoholhydrocarbon derivativeprimary amineorganic nitrogen compoundorganic phosphoric acid derivativeaminealkyl phosphateorganooxygen compound |
|---|
