| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:53:06 UTC |
|---|
| Update Date | 2025-03-25 00:51:13 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02185555 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C19H30O11 |
|---|
| Molecular Mass | 434.1788 |
|---|
| SMILES | OCC1C(O)C(O)C(O)C(OCOC(O)CCC(O)Cc2ccc(O)c(O)c2)C1O |
|---|
| InChI Key | OOXMXWFTMUTNPD-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | fatty acyls |
|---|
| Subclass | fatty alcohols |
|---|
| Direct Parent | fatty alcohols |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsacetalsbenzene and substituted derivativescyclitols and derivativescyclohexanolshemiacetalshydrocarbon derivativesprimary alcohols |
|---|
| Substituents | alcoholmonocyclic benzene moietycyclohexanol1-hydroxy-2-unsubstituted benzenoidcyclitol or derivatives1-hydroxy-4-unsubstituted benzenoidcyclic alcoholaromatic homomonocyclic compoundorganic oxygen compoundacetalfatty alcoholsecondary alcoholphenolhemiacetalhydrocarbon derivativebenzenoidprimary alcoholorganooxygen compound |
|---|
