| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:53:07 UTC |
|---|
| Update Date | 2025-03-25 00:51:14 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02185582 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H14N10O2 |
|---|
| Molecular Mass | 366.1301 |
|---|
| SMILES | Nc1ncnc2c1ncn2C1COC2C1OC2n1cnc2c(N)ncnc21 |
|---|
| InChI Key | ARYWGWFXFGZFCT-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | imidazopyrimidines |
|---|
| Subclass | purines and purine derivatives |
|---|
| Direct Parent | purines and purine derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1,4-dioxepanesazacyclic compoundsdialkyl ethersheteroaromatic compoundshydrocarbon derivativesimidazolesimidolactamsn-substituted imidazolesorganopnictogen compoundsoxacyclic compoundsoxetanesprimary aminespyrimidines and pyrimidine derivativestetrahydrofurans |
|---|
| Substituents | etherdialkyl etherpyrimidinearomatic heteropolycyclic compoundimidazoleorganonitrogen compoundorganopnictogen compoundimidolactamazolen-substituted imidazoleazacycletetrahydrofuran1,4-dioxepaneheteroaromatic compounddioxepaneoxacycleorganic oxygen compoundoxetanehydrocarbon derivativeprimary aminepurineorganic nitrogen compoundamineorganooxygen compound |
|---|
