| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:53:09 UTC |
|---|
| Update Date | 2025-03-25 00:51:14 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02185652 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H18N5O9P |
|---|
| Molecular Mass | 383.0842 |
|---|
| SMILES | Nc1nc(NCCO)nc(=O)n1C1OC(COP(=O)(O)O)C(O)C1O |
|---|
| InChI Key | VHPWGSLVXLGVKJ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | pentose phosphates |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | alkanolaminesazacyclic compoundshalo-s-triazinesheteroaromatic compoundshydrocarbon derivativesmonoalkyl phosphatesmonosaccharidesn-aliphatic s-triazinesorganic carbonic acids and derivativesorganic oxidesorganopnictogen compoundsoxacyclic compoundsprimary aminessecondary alcoholssecondary alkylarylaminestetrahydrofuranstriazinones |
|---|
| Substituents | n-aliphatic s-triazineamino-1,3,5-triazinearomatic heteromonocyclic compoundpentose phosphatepentose-5-phosphateorganic oxideorganonitrogen compoundorganopnictogen compoundorganoheterocyclic compoundalkanolaminealcoholcarbonic acid derivativeazacycletetrahydrofuranaminotriazineheteroaromatic compoundsecondary aminesecondary aliphatic/aromatic amineoxacyclephosphoric acid esterhalo-s-triazinemonoalkyl phosphatesecondary alcoholtriazinehydrocarbon derivative1,3,5-triazineprimary amineorganic nitrogen compoundorganic phosphoric acid derivativeaminetriazinonealkyl phosphate |
|---|
