| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:53:09 UTC |
|---|
| Update Date | 2025-03-25 00:51:15 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02185674 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H16N6O5 |
|---|
| Molecular Mass | 324.1182 |
|---|
| SMILES | Nc1nc(N)c2nc(COC3OC(CO)C(O)C3O)cnc2n1 |
|---|
| InChI Key | GUCZEIRNTUSVBC-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pteridines and derivatives |
|---|
| Subclass | pteridines and derivatives |
|---|
| Direct Parent | pteridines and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | acetalsazacyclic compoundsheteroaromatic compoundshydrocarbon derivativesimidolactamsmonosaccharidesorganopnictogen compoundsoxacyclic compoundsprimary alcoholsprimary aminespyrazinespyrimidines and pyrimidine derivativessecondary alcoholstetrahydrofurans |
|---|
| Substituents | monosaccharidepteridinepyrimidinesaccharideacetalaromatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundprimary alcoholimidolactamalcoholazacycletetrahydrofuranheteroaromatic compoundoxacycleorganic oxygen compoundpyrazinesecondary alcoholhydrocarbon derivativeprimary amineorganic nitrogen compoundamineorganooxygen compound |
|---|
