| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:53:09 UTC |
|---|
| Update Date | 2025-03-25 00:51:15 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02185675 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H15N5O7 |
|---|
| Molecular Mass | 341.0971 |
|---|
| SMILES | Nc1nc(=O)c2c([nH]1)N(C1OC(CO)C(O)C1O)CC(C(=O)O)=N2 |
|---|
| InChI Key | RPOZJGUGBCLFGH-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pteridines and derivatives |
|---|
| Subclass | pterins and derivatives |
|---|
| Direct Parent | pterin carboxylates |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | amino acidsazacyclic compoundscarbonyl compoundscarboxylic acidsdialkylarylaminesheteroaromatic compoundshydrocarbon derivativesketiminesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesorganopnictogen compoundsoxacyclic compoundsprimary alcoholsprimary aminespropargyl-type 1,3-dipolar organic compoundspyrimidonessecondary alcoholstetrahydrofuransvinylogous amides |
|---|
| Substituents | ketiminecarbonyl groupcarboxylic acidamino acid or derivativesamino acidiminemonosaccharidepyrimidonecarboxylic acid derivativepyrimidinepropargyl-type 1,3-dipolar organic compoundsaccharideorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compounddialkylarylamineprimary alcoholalcoholvinylogous amideazacycletetrahydrofuranheteroaromatic compoundorganic 1,3-dipolar compoundpterin-6-carboxylateoxacyclemonocarboxylic acid or derivativesorganic oxygen compoundsecondary alcoholhydrocarbon derivativeprimary amineorganic nitrogen compoundamineorganooxygen compound |
|---|