| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:53:10 UTC |
|---|
| Update Date | 2025-03-25 00:51:15 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02185691 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C21H22O7 |
|---|
| Molecular Mass | 386.1366 |
|---|
| SMILES | OCC1OC(COc2ccc3c(ccc4cc(O)ccc43)c2)C(O)C(O)C1O |
|---|
| InChI Key | ZTFQPTUWLZVQRV-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | phenanthrenes and derivatives |
|---|
| Subclass | phenanthrols |
|---|
| Direct Parent | phenanthrols |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsalkyl aryl ethersdialkyl ethershydrocarbon derivativesmonosaccharidesnaphthols and derivativesoxacyclic compoundsoxanesphenol ethersprimary alcoholssecondary alcohols |
|---|
| Substituents | alcoholphenol etheretherphenanthrol1-hydroxy-2-unsubstituted benzenoidmonosaccharidealkyl aryl etherdialkyl etheroxacyclesaccharidenaphthaleneorganic oxygen compoundaromatic heteropolycyclic compoundsecondary alcoholhydrocarbon derivativeoxaneprimary alcohol2-naphtholorganoheterocyclic compoundorganooxygen compound |
|---|
