| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:53:10 UTC |
|---|
| Update Date | 2025-03-25 00:51:15 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02185713 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H13N5O4 |
|---|
| Molecular Mass | 315.0968 |
|---|
| SMILES | Nc1nc(=O)c2c([nH]1)NCC(C(O)c1ccc3c(c1)OCO3)=N2 |
|---|
| InChI Key | YKGYKEIJLYHOJI-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pteridines and derivatives |
|---|
| Subclass | pterins and derivatives |
|---|
| Direct Parent | pterins and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | acetalsaromatic alcoholsazacyclic compoundsbenzenoidsbenzodioxolesheteroaromatic compoundshydrocarbon derivativesketiminesorganic oxidesorganopnictogen compoundsoxacyclic compoundsprimary aminespropargyl-type 1,3-dipolar organic compoundspyrimidonessecondary alcoholssecondary alkylarylaminesvinylogous amides |
|---|
| Substituents | aromatic alcoholketimineiminepyrimidonepyrimidinepropargyl-type 1,3-dipolar organic compoundorganic oxideacetalaromatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundbenzodioxolealcoholvinylogous amidepterinazacycleheteroaromatic compoundorganic 1,3-dipolar compoundsecondary aminesecondary aliphatic/aromatic amineoxacycleorganic oxygen compoundsecondary alcoholhydrocarbon derivativebenzenoidprimary amineorganic nitrogen compoundamineorganooxygen compound |
|---|