| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:53:12 UTC |
|---|
| Update Date | 2025-03-25 00:51:16 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02185794 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H20N5O8P |
|---|
| Molecular Mass | 393.1049 |
|---|
| SMILES | Nc1nc2c(c(=O)[nH]1)N(C1C(O)C(O)C(COP(=O)(O)O)C1O)CCN2 |
|---|
| InChI Key | WEOKPOHURKSHCJ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pteridines and derivatives |
|---|
| Subclass | pterins and derivatives |
|---|
| Direct Parent | pterins and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1,2-aminoalcoholsaminocyclitols and derivativesazacyclic compoundscyclopentanolsdialkylarylaminesheteroaromatic compoundshydrocarbon derivativesimidolactamslactamsmonoalkyl phosphatesorganic oxidesorganopnictogen compoundsprimary aminespyrimidonessecondary alkylarylaminesvinylogous amides |
|---|
| Substituents | lactampyrimidonepyrimidineorganic oxidearomatic heteropolycyclic compoundtertiary aliphatic/aromatic amineorganonitrogen compoundorganopnictogen compounddialkylarylamineimidolactamtertiary amineaminocyclitol or derivativesalcoholvinylogous amidepterinazacycle1,2-aminoalcoholheteroaromatic compoundcyclitol or derivativescyclic alcoholsecondary aminesecondary aliphatic/aromatic aminecyclopentanolorganic oxygen compoundphosphoric acid estermonoalkyl phosphatesecondary alcoholhydrocarbon derivativeprimary amineorganic nitrogen compoundorganic phosphoric acid derivativeaminealkyl phosphateorganooxygen compound |
|---|
