| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:53:13 UTC |
|---|
| Update Date | 2025-03-25 00:51:16 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02185810 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C5H5N5O3S |
|---|
| Molecular Mass | 215.0113 |
|---|
| SMILES | Nc1nc2c(S(=O)(=O)O)ncnc2[nH]1 |
|---|
| InChI Key | LDBRKGYNINOIJP-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | imidazopyrimidines |
|---|
| Subclass | purines and purine derivatives |
|---|
| Direct Parent | purines and purine derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | arylsulfonic acids and derivativesazacyclic compoundsheteroaromatic compoundshydrocarbon derivativesimidazolesorganic oxidesorganopnictogen compoundsorganosulfonic acidsprimary aminespyrimidines and pyrimidine derivativessulfonyls |
|---|
| Substituents | organosulfonic acid or derivativesazacycleorganosulfonic acidheteroaromatic compoundorganosulfur compoundpyrimidineorganic oxidesulfonylarylsulfonic acid or derivativesorganic oxygen compoundaromatic heteropolycyclic compoundorganic sulfonic acid or derivativesimidazoleorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeprimary aminepurineorganic nitrogen compoundamineazole |
|---|