| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:53:14 UTC |
|---|
| Update Date | 2025-03-25 00:51:16 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02185852 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H16O7 |
|---|
| Molecular Mass | 332.0896 |
|---|
| SMILES | O=C(CCc1ccc(O)cc1)OCOC(=O)c1ccc(O)c(O)c1 |
|---|
| InChI Key | ZPAMLBBPQBIBSY-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzoic acids and derivatives |
|---|
| Direct Parent | p-hydroxybenzoic acid alkyl esters |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsacetalsbenzoyl derivativescarbonyl compoundscarboxylic acid estersdicarboxylic acids and derivativesfatty acid estershydrocarbon derivativesorganic oxidesm-hydroxybenzoic acid esters |
|---|
| Substituents | fatty acylcarbonyl groupbenzoyl1-hydroxy-2-unsubstituted benzenoid1-hydroxy-4-unsubstituted benzenoidcarboxylic acid derivativep-hydroxybenzoic acid alkyl esteraromatic homomonocyclic compoundfatty acid esterorganic oxideorganic oxygen compoundacetalcarboxylic acid esterdicarboxylic acid or derivativesphenolhydrocarbon derivativem-hydroxybenzoic acid esterorganooxygen compound |
|---|
