| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:53:14 UTC |
|---|
| Update Date | 2025-03-25 00:51:17 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02185862 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C26H28N2O3 |
|---|
| Molecular Mass | 416.21 |
|---|
| SMILES | O=C(CN1CCC(C(O)(c2ccccc2)c2ccccc2)CC1)Nc1ccc(O)cc1 |
|---|
| InChI Key | JXTKPYLUENHYCL-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | diphenylmethanes |
|---|
| Direct Parent | diphenylmethanes |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsalpha amino acid amidesalpha amino acidsanilidesaromatic alcoholsazacyclic compoundscarbonyl compoundscarboxylic acids and derivativeshydrocarbon derivativesn-arylamidesorganic oxidesorganopnictogen compoundspiperidinessecondary carboxylic acid amidestertiary alcoholstrialkylamines |
|---|
| Substituents | aromatic alcoholdiphenylmethanecarbonyl grouparomatic heteromonocyclic compoundamino acid or derivatives1-hydroxy-2-unsubstituted benzenoidn-arylamidealpha-amino acid or derivativescarboxylic acid derivativeorganic oxideorganonitrogen compoundalpha-amino acidorganopnictogen compoundpiperidinetertiary amineorganoheterocyclic compoundalcoholalpha-amino acid amideazacycletertiary aliphatic aminecarboxamide groupanilidesecondary carboxylic acid amidetertiary alcoholorganic oxygen compoundphenolhydrocarbon derivativeorganic nitrogen compoundamineorganooxygen compound |
|---|
