Record Information |
---|
HMDB Status | Not Available |
---|
Creation Date | 2024-02-21 14:53:15 UTC |
---|
Update Date | 2025-03-25 00:51:17 UTC |
---|
HMDB ID | Not Available |
---|
Metabolite Identification |
---|
DeepMet ID | DMID02185888 |
---|
Frequency | 0.5 |
---|
Structure | |
---|
Chemical Formula | C11H15NO7S |
---|
Molecular Mass | 305.0569 |
---|
SMILES | O=C(CCC(O)Cc1ccncc1)OCOS(=O)(=O)O |
---|
InChI Key | LNPDSYMWUPPHQJ-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | lipids and lipid-like molecules |
---|
Class | fatty acyls |
---|
Subclass | fatty acid esters |
---|
Direct Parent | fatty acid esters |
---|
Geometric Descriptor | aromatic heteromonocyclic compounds |
---|
Alternative Parents | alkyl sulfatesazacyclic compoundscarbonyl compoundscarboxylic acid estersheteroaromatic compoundshydrocarbon derivativeshydroxypyridinesmonocarboxylic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundssecondary alcoholssulfuric acid monoesters |
---|
Substituents | sulfuric acid monoestercarbonyl grouparomatic heteromonocyclic compoundcarboxylic acid derivativeorganic oxidealkyl sulfateorganonitrogen compoundorganopnictogen compoundorganoheterocyclic compoundalcoholorganic sulfuric acid or derivativesazacycleheteroaromatic compoundhydroxypyridinefatty acid estermonocarboxylic acid or derivativespyridineorganic oxygen compoundcarboxylic acid estersecondary alcoholsulfate-esterhydrocarbon derivativeorganic nitrogen compoundsulfuric acid esterorganooxygen compound |
---|