| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:53:16 UTC |
|---|
| Update Date | 2025-03-25 00:51:17 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02185927 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C18H20O4 |
|---|
| Molecular Mass | 300.1362 |
|---|
| SMILES | O=C(Cc1ccccc1)OCC(O)COCc1ccccc1 |
|---|
| InChI Key | WXOZCXWKYKJPTE-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | glycerolipids |
|---|
| Subclass | other glycerolipids |
|---|
| Direct Parent | other glycerolipids |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-alkyl,3-acylglycerolsbenzyletherscarbonyl compoundscarboxylic acid estersdialkyl ethersglycerol ethershydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidessecondary alcohols |
|---|
| Substituents | alcoholmonocyclic benzene moietycarbonyl groupetherbenzylether1-alkyl,3-acylglycerolcarboxylic acid derivativedialkyl etheraromatic homomonocyclic compoundorganic oxidemonocarboxylic acid or derivatives1,3-dialkyl-sn-glycerolorganic oxygen compoundcarboxylic acid estersecondary alcoholhydrocarbon derivativebenzenoidglycerol etherorganooxygen compound |
|---|
