| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:53:16 UTC |
|---|
| Update Date | 2025-03-25 00:51:17 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02185947 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C18H24N2O5 |
|---|
| Molecular Mass | 348.1685 |
|---|
| SMILES | O=C(NC(Cc1ccccc1)C(O)CN1CCC1=O)OC1CCOC1 |
|---|
| InChI Key | SHSGVGKPUHKPQQ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | lactams |
|---|
| Subclass | beta lactams |
|---|
| Direct Parent | monobactams |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | amphetamines and derivativesazacyclic compoundsazetidinescarbamate esterscarbonyl compoundscarboxylic acids and derivativesdialkyl ethershydrocarbon derivativesorganic carbonic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsphenylbutylaminessecondary alcoholstertiary carboxylic acid amidestetrahydrofurans |
|---|
| Substituents | monocyclic benzene moietycarbonyl groupetheraromatic heteromonocyclic compoundmonobactamcarboxylic acid derivativedialkyl etherorganic oxidephenylbutylaminetertiary carboxylic acid amideorganonitrogen compoundorganopnictogen compoundamphetamine or derivativesalcoholcarbonic acid derivativeazacycletetrahydrofurancarbamic acid estercarboxamide groupazetidineoxacycleorganic oxygen compoundsecondary alcoholhydrocarbon derivativebenzenoidorganic nitrogen compoundorganooxygen compound |
|---|
