| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:53:19 UTC |
|---|
| Update Date | 2025-03-25 00:51:18 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02186040 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C5H10O8S |
|---|
| Molecular Mass | 230.0096 |
|---|
| SMILES | O=C(C(O)CO)C(O)COS(=O)(=O)O |
|---|
| InChI Key | IUMNOPLVZLSYIF-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic sulfuric acids and derivatives |
|---|
| Subclass | sulfuric acid esters |
|---|
| Direct Parent | sulfuric acid monoesters |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | acyloinsalkyl sulfatesalpha-hydroxy ketonesbeta-hydroxy ketoneshydrocarbon derivativesmonosaccharidesorganic oxidesprimary alcoholssecondary alcohols |
|---|
| Substituents | alcoholbeta-hydroxy ketonealiphatic acyclic compoundsulfuric acid monoestercarbonyl groupmonosaccharidealpha-hydroxy ketoneketonesaccharideorganic oxideorganic oxygen compoundacyloinalkyl sulfatesecondary alcoholsulfate-esterhydrocarbon derivativeprimary alcoholorganooxygen compound |
|---|
