| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:53:20 UTC |
|---|
| Update Date | 2025-03-25 00:51:19 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02186091 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H18FN5O7S |
|---|
| Molecular Mass | 431.0911 |
|---|
| SMILES | Nc1ncnc2c1ncn2C1OC(CSCCC(F)(C(=O)O)C(=O)O)C(O)C1O |
|---|
| InChI Key | RLHAKDRWYIMCOV-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | nucleosides, nucleotides, and analogues |
|---|
| Class | 5'-deoxyribonucleosides |
|---|
| Subclass | 5'-deoxy-5'-thionucleosides |
|---|
| Direct Parent | 5'-s-alkylthio-5'-deoxyribonucleosides |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1,2-diolsalkyl fluoridesalpha-halocarboxylic acidsamino acidsazacyclic compoundscarbonyl compoundscarboxylic acidsdialkylthioethersdicarboxylic acids and derivativesfatty acylshalogenated fatty acidsheteroaromatic compoundshydrocarbon derivativeshydroxy fatty acidsimidazolesimidolactamsmonosaccharidesn-substituted imidazolesorganic oxidesorganofluoridesorganopnictogen compoundsoxacyclic compoundsprimary aminespurines and purine derivativespyrimidines and pyrimidine derivativessecondary alcoholssulfenyl compoundstetrahydrofuransthia fatty acids |
|---|
| Substituents | alpha-halocarboxylic acid or derivativescarboxylic acidamino acid or derivativesmonosaccharideimidazopyrimidinealpha-halocarboxylic acidsaccharideorganonitrogen compoundhydroxy fatty acidorganoheterocyclic compound1,2-diolalcoholsulfenyl compoundazacyclealkyl fluoridedialkylthioetherheteroaromatic compoundthioetherdicarboxylic acid or derivativeshydrocarbon derivativeprimary amineaminefatty acylcarbonyl groupamino acidorganosulfur compoundcarboxylic acid derivativeorganohalogen compoundpyrimidineorganic oxide5'-s-alkylthio-5'-deoxyribonucleosidearomatic heteropolycyclic compoundimidazoleorganopnictogen compoundalkyl halideimidolactamazolen-substituted imidazolehalogenated fatty acidtetrahydrofuranorganofluorideoxacyclethia fatty acidorganic oxygen compoundsecondary alcoholpurineorganic nitrogen compoundorganooxygen compound |
|---|