| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:53:20 UTC |
|---|
| Update Date | 2025-03-25 00:51:19 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02186108 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H14N6 |
|---|
| Molecular Mass | 278.128 |
|---|
| SMILES | Nc1ncnc2c1ncn2CCc1c[nH]c2ccccc12 |
|---|
| InChI Key | JPVBDZRYFMSZHW-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | imidazopyrimidines |
|---|
| Subclass | purines and purine derivatives |
|---|
| Direct Parent | purines and purine derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsbenzenoidsheteroaromatic compoundshydrocarbon derivativesimidazolesimidolactamsindolesn-substituted imidazolesorganopnictogen compoundsprimary aminespyrimidines and pyrimidine derivativespyrroles |
|---|
| Substituents | azacycleindoleheteroaromatic compoundindole or derivativespyrimidinearomatic heteropolycyclic compoundimidazolepyrroleorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativebenzenoidprimary aminepurineorganic nitrogen compoundimidolactamamineazolen-substituted imidazole |
|---|
