| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:53:20 UTC |
|---|
| Update Date | 2025-03-25 00:51:18 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02186109 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H9Cl2N5 |
|---|
| Molecular Mass | 293.0235 |
|---|
| SMILES | Nc1ncnc2c1ncn2Cc1c(Cl)cccc1Cl |
|---|
| InChI Key | IZCBDBAVZPTJIH-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | imidazopyrimidines |
|---|
| Subclass | purines and purine derivatives |
|---|
| Direct Parent | purines and purine derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | aryl chloridesazacyclic compoundsdichlorobenzenesheteroaromatic compoundshydrocarbon derivativesimidazolesimidolactamsn-substituted imidazolesorganochloridesorganopnictogen compoundsprimary aminespyrimidines and pyrimidine derivatives |
|---|
| Substituents | monocyclic benzene moietyorganochlorideorganohalogen compoundpyrimidine1,3-dichlorobenzenearomatic heteropolycyclic compoundimidazoleorganonitrogen compoundorganopnictogen compoundimidolactamazolen-substituted imidazolearyl chloridechlorobenzeneazacycleheteroaromatic compoundaryl halidehydrocarbon derivativebenzenoidprimary aminepurineorganic nitrogen compoundhalobenzeneamine |
|---|
