| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:53:28 UTC |
|---|
| Update Date | 2025-03-25 00:51:21 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02186419 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H22N2O9 |
|---|
| Molecular Mass | 398.1325 |
|---|
| SMILES | NC1C(O)CC(O)(C(=O)O)OC1C(O)C(=O)NC(Cc1ccccc1)C(=O)O |
|---|
| InChI Key | JVMUIUKULMJKSQ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | phenylalanine and derivatives |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | alpha amino acidsalpha hydroxy acids and derivativesamphetamines and derivativesbenzene and substituted derivativesc-glucuronidescarbonyl compoundscarboxylic acidsdelta amino acids and derivativesdicarboxylic acids and derivativesgamma amino acids and derivativeshemiacetalshydrocarbon derivativesmonoalkylaminesn-acyl-alpha amino acidsorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanesphenylpropanoic acidspyran carboxylic acidssecondary alcoholssecondary carboxylic acid amides |
|---|
| Substituents | monocyclic benzene moietycarbonyl groupcarboxylic acidaromatic heteromonocyclic compound3-phenylpropanoic-acidgamma amino acid or derivativesalpha-hydroxy acidpyran carboxylic acidorganic oxideorganonitrogen compoundalpha-amino acidorganopnictogen compoundhemiacetaldelta amino acid or derivativesoxaneorganoheterocyclic compoundamphetamine or derivativesn-acyl-alpha amino acid or derivativesc-glucuronidealcoholpyran carboxylic acid or derivativesn-acyl-alpha-amino acidhydroxy acidcarboxamide groupoxacyclesecondary carboxylic acid amidephenylalanine or derivativesorganic oxygen compoundpyransecondary alcoholdicarboxylic acid or derivativeshydrocarbon derivativebenzenoidprimary aliphatic amineorganic nitrogen compoundorganooxygen compound |
|---|