| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:53:30 UTC |
|---|
| Update Date | 2025-03-25 00:51:22 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02186495 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H10N6O4 |
|---|
| Molecular Mass | 266.0764 |
|---|
| SMILES | NCC(O)(C(=O)O)c1cnc2nc(N)[nH]c(=O)c2n1 |
|---|
| InChI Key | OTDCAOKRSRVWBE-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pteridines and derivatives |
|---|
| Subclass | pterins and derivatives |
|---|
| Direct Parent | pterins and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | alpha hydroxy acids and derivativesamino acidsaromatic alcoholsazacyclic compoundsbeta amino acids and derivativescarbonyl compoundscarboxylic acidsheteroaromatic compoundshydrocarbon derivativeslactamsmonoalkylaminesmonocarboxylic acids and derivativesorganic oxidesorganopnictogen compoundspyrazinespyrimidonestertiary alcohols |
|---|
| Substituents | aromatic alcoholcarbonyl grouplactamcarboxylic acidamino acid or derivativesamino acidalpha-hydroxy acidpyrimidonecarboxylic acid derivativepyrimidineorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundalcoholpterinazacycleheteroaromatic compoundhydroxy acidbeta amino acid or derivativestertiary alcoholmonocarboxylic acid or derivativesorganic oxygen compoundpyrazinehydrocarbon derivativeprimary aliphatic amineprimary amineorganic nitrogen compoundamineorganooxygen compound |
|---|
