| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:53:32 UTC |
|---|
| Update Date | 2025-03-25 00:51:22 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02186547 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C19H28O10 |
|---|
| Molecular Mass | 416.1682 |
|---|
| SMILES | OCC1OC(OC2C(Cc3ccccc3)OC(CO)C(O)C2O)C(O)C(O)C1O |
|---|
| InChI Key | NIPITUIAKSFUIG-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | monosaccharides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetalsbenzene and substituted derivativesdialkyl ethershydrocarbon derivativesoxacyclic compoundsoxanesprimary alcoholssecondary alcohols |
|---|
| Substituents | alcoholmonocyclic benzene moietyetheraromatic heteromonocyclic compoundmonosaccharidedialkyl etheroxacycleacetalsecondary alcoholhydrocarbon derivativebenzenoidoxaneprimary alcoholorganoheterocyclic compound |
|---|