| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:53:34 UTC |
|---|
| Update Date | 2025-03-25 00:51:24 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02186661 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H12N2O7S |
|---|
| Molecular Mass | 304.0365 |
|---|
| SMILES | Nc1c(O)ccc(S(=O)(=O)O)c1C(=O)CC(N)C(=O)O |
|---|
| InChI Key | CNBNBTNLJKCJQG-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbonyl compounds |
|---|
| Direct Parent | alkyl-phenylketones |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-sulfo,2-unsubstituted aromatic compoundsalpha amino acidsamino acidsaryl alkyl ketonesarylsulfonic acids and derivativesbenzenesulfonic acids and derivativesbenzenesulfonyl compoundsbenzoyl derivativesbutyrophenonescarboxylic acidsgamma-keto acids and derivativeshydrocarbon derivativesmonoalkylaminesmonocarboxylic acids and derivativesorganic oxidesorganopnictogen compoundsorganosulfonic acidssulfonylsvinylogous amides |
|---|
| Substituents | organosulfonic acid or derivativesmonocyclic benzene moietycarboxylic acidaryl alkyl ketoneamino acid or derivativesamino acidorganosulfonic acidbenzoyl1-hydroxy-2-unsubstituted benzenoidalpha-amino acid or derivativesbenzenesulfonateorganosulfur compoundcarboxylic acid derivativeorganic oxideorganonitrogen compoundalpha-amino acidorganopnictogen compoundbenzenesulfonyl groupvinylogous amide1-sulfo,2-unsubstituted aromatic compoundgamma-keto acidbutyrophenonearomatic homomonocyclic compoundmonocarboxylic acid or derivativessulfonylarylsulfonic acid or derivativesorganic sulfonic acid or derivativesketo acidphenolhydrocarbon derivativebenzenoidprimary aliphatic amineprimary amineorganic nitrogen compoundaminealkyl-phenylketone |
|---|