| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:53:35 UTC |
|---|
| Update Date | 2025-03-25 00:51:23 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02186697 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H14N2O3 |
|---|
| Molecular Mass | 234.1004 |
|---|
| SMILES | Nc1c(O)cccc1C(=O)C1CCCC(=O)N1 |
|---|
| InChI Key | ZVWJWCXLHDMFDR-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbonyl compounds |
|---|
| Direct Parent | alkyl-phenylketones |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsamino acids and derivativesaryl alkyl ketonesazacyclic compoundsbenzoyl derivativescarboxylic acids and derivativesdelta lactamshydrocarbon derivativesorganic oxidesorganopnictogen compoundspiperidinonesprimary aminessecondary carboxylic acid amidesvinylogous amides |
|---|
| Substituents | monocyclic benzene moietylactamaryl alkyl ketonearomatic heteromonocyclic compoundamino acid or derivativesbenzoyl1-hydroxy-2-unsubstituted benzenoidcarboxylic acid derivativeorganic oxideorganonitrogen compoundorganopnictogen compoundpiperidinonepiperidineorganoheterocyclic compoundvinylogous amideazacycle1-hydroxy-4-unsubstituted benzenoidcarboxamide groupdelta-lactamsecondary carboxylic acid amidephenolhydrocarbon derivativebenzenoidprimary amineorganic nitrogen compoundaminealkyl-phenylketone |
|---|