| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:53:36 UTC |
|---|
| Update Date | 2025-03-25 00:51:24 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02186733 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H13N4O6P |
|---|
| Molecular Mass | 280.0573 |
|---|
| SMILES | Nc1cnnn1C1CC(O)C(COP(=O)(O)O)O1 |
|---|
| InChI Key | HRFKBIYIYRDSHW-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | nucleosides, nucleotides, and analogues |
|---|
| Class | triazole ribonucleosides and ribonucleotides |
|---|
| Subclass | triazole ribonucleosides and ribonucleotides |
|---|
| Direct Parent | triazole ribonucleosides and ribonucleotides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsheteroaromatic compoundshydrocarbon derivativesmonoalkyl phosphatesmonosaccharidesorganic oxidesorganopnictogen compoundsoxacyclic compoundspentose phosphatesprimary aminessecondary alcoholstetrahydrofuranstriazoles |
|---|
| Substituents | n-ribosyl-1,2,3-triazoletriazolearomatic heteromonocyclic compoundpentose phosphatemonosaccharidesaccharideorganic oxideorganonitrogen compoundorganopnictogen compound1,2,3-triazoleorganoheterocyclic compoundazolealcoholazacycletetrahydrofuranheteroaromatic compoundoxacycleorganic oxygen compoundphosphoric acid estermonoalkyl phosphatesecondary alcoholhydrocarbon derivativeprimary amineorganic nitrogen compoundorganic phosphoric acid derivativeaminealkyl phosphateorganooxygen compound |
|---|
