Record Information |
---|
HMDB Status | Not Available |
---|
Creation Date | 2024-02-21 14:53:37 UTC |
---|
Update Date | 2025-03-25 00:51:25 UTC |
---|
HMDB ID | Not Available |
---|
Metabolite Identification |
---|
DeepMet ID | DMID02186787 |
---|
Frequency | 0.5 |
---|
Structure | |
---|
Chemical Formula | C8H8N2O6S |
---|
Molecular Mass | 260.0103 |
---|
SMILES | Nc1cccc2c1NC(=O)C(OS(=O)(=O)O)O2 |
---|
InChI Key | KQAUQQGBDNBQFI-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | organoheterocyclic compounds |
---|
Class | benzoxazines |
---|
Subclass | benzoxazinones |
---|
Direct Parent | benzoxazinones |
---|
Geometric Descriptor | aromatic heteropolycyclic compounds |
---|
Alternative Parents | alkyl sulfatesamino acids and derivativesazacyclic compoundsbenzenoidsbenzomorpholinescarbonyl compoundscarboxylic acids and derivativeshydrocarbon derivativeslactamsorganic oxidesorganopnictogen compoundsoxacyclic compoundsprimary aminessecondary carboxylic acid amidessulfuric acid monoesters |
---|
Substituents | sulfuric acid monoestercarbonyl grouplactamamino acid or derivativescarboxylic acid derivativebenzomorpholineorganic oxidearomatic heteropolycyclic compoundalkyl sulfateorganonitrogen compoundorganopnictogen compoundorganic sulfuric acid or derivativesazacyclecarboxamide groupoxazinaneoxacyclesecondary carboxylic acid amidemorpholinebenzoxazinoneorganic oxygen compoundsulfate-esterhydrocarbon derivativebenzenoidprimary amineorganic nitrogen compoundsulfuric acid esteramineorganooxygen compound |
---|