| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:53:41 UTC |
|---|
| Update Date | 2025-03-25 00:51:25 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02186908 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H17ClN2O8S |
|---|
| Molecular Mass | 396.0394 |
|---|
| SMILES | NS(=O)(=O)c1cc(C(=O)O)c(NCC2OCC(O)C(O)C2O)cc1Cl |
|---|
| InChI Key | ALQCLDWNORPLTA-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzenesulfonamides |
|---|
| Direct Parent | benzenesulfonamides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1-carboxy-2-haloaromatic compounds4-halobenzoic acidsamino acidsaminosulfonyl compoundsaryl chloridesbenzenesulfonyl compoundsbenzoic acidsbenzoyl derivativeschlorobenzenesdialkyl ethershalobenzoic acidshydrocarbon derivativesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesorganochloridesorganopnictogen compoundsorganosulfonamidesoxacyclic compoundsoxanesphenylalkylaminessecondary alcoholssecondary alkylarylaminesvinylogous amides |
|---|
| Substituents | carboxylic acidamino acid or derivativesorganochloridebenzoylmonosaccharidedialkyl ethersaccharideorganonitrogen compound1-carboxy-2-haloaromatic compoundoxaneorganoheterocyclic compoundbenzenesulfonyl grouparyl chloridechlorobenzenealcoholvinylogous amidehalobenzoic acidbenzenesulfonamide4-halobenzoic acidsecondary aliphatic/aromatic aminearyl halide4-halobenzoic acid or derivativeshydrocarbon derivativehalobenzeneamineorganosulfonic acid or derivativesetheraromatic heteromonocyclic compoundamino acidorganosulfur compoundcarboxylic acid derivativeorganohalogen compoundorganosulfonic acid amideorganic oxideorganopnictogen compoundbenzoic acidaminosulfonyl compoundbenzoic acid or derivativeshalobenzoic acid or derivativessecondary amineoxacyclemonocarboxylic acid or derivativessulfonylorganic oxygen compoundorganic sulfonic acid or derivativessecondary alcoholphenylalkylamineorganic nitrogen compoundorganooxygen compound |
|---|