| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:53:41 UTC |
|---|
| Update Date | 2025-03-25 00:51:25 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02186916 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H11ClN2O5S2 |
|---|
| Molecular Mass | 361.9798 |
|---|
| SMILES | NS(=O)(=O)c1cc(S(=O)(=O)O)c(Nc2ccccc2)cc1Cl |
|---|
| InChI Key | OZNYIGJNCQHURF-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzenesulfonamides |
|---|
| Direct Parent | benzenesulfonamides |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-sulfo,2-unsubstituted aromatic compoundsaminosulfonyl compoundsaryl chloridesarylsulfonic acids and derivativesbenzenesulfonic acids and derivativesbenzenesulfonyl compoundschlorobenzeneshydrocarbon derivativesorganic oxidesorganochloridesorganopnictogen compoundsorganosulfonamidesorganosulfonic acidssecondary amines |
|---|
| Substituents | organosulfonic acid or derivativesorganochlorideorganosulfonic acidbenzenesulfonateorganosulfur compoundorganohalogen compoundorganosulfonic acid amideorganic oxideorganonitrogen compoundorganopnictogen compoundbenzenesulfonyl grouparyl chloridechlorobenzenebenzenesulfonamide1-sulfo,2-unsubstituted aromatic compoundaminosulfonyl compoundsecondary aminearyl halidearomatic homomonocyclic compoundsulfonylarylsulfonic acid or derivativesorganic oxygen compoundorganic sulfonic acid or derivativeshydrocarbon derivativeorganic nitrogen compoundhalobenzeneamine |
|---|
