| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:53:41 UTC |
|---|
| Update Date | 2025-03-25 00:51:26 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02186933 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H9NO4S |
|---|
| Molecular Mass | 239.0252 |
|---|
| SMILES | NS(=O)(=O)c1ccc(O)c2c(O)cccc12 |
|---|
| InChI Key | QKXPRLXXSRFRSW-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | naphthalenes |
|---|
| Subclass | naphthalene sulfonic acids and derivatives |
|---|
| Direct Parent | 1-naphthalene sulfonic acids and derivatives |
|---|
| Geometric Descriptor | aromatic homopolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoids1-naphthalene sulfonamidesaminosulfonyl compoundshydrocarbon derivativesnaphthols and derivativesorganic nitrogen compoundsorganic oxidesorganooxygen compoundsorganosulfonamides |
|---|
| Substituents | organosulfonic acid or derivativesaminosulfonyl compound1-hydroxy-2-unsubstituted benzenoidaromatic homopolycyclic compoundnaphthalene sulfonamide1-hydroxy-4-unsubstituted benzenoidorganosulfur compound1-naphthalene sulfonic acid or derivativesorganosulfonic acid amideorganic oxidesulfonylorganic oxygen compoundorganic sulfonic acid or derivativeshydrocarbon derivative1-naphtholorganic nitrogen compound1-naphthalene sulfonamideorganooxygen compound |
|---|
