| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:53:43 UTC |
|---|
| Update Date | 2025-03-25 00:51:26 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02187017 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C20H23Cl2NO2 |
|---|
| Molecular Mass | 379.1106 |
|---|
| SMILES | CC(C(=O)O)c1ccc(C(CCN(C)C)c2ccc(Cl)c(Cl)c2)cc1 |
|---|
| InChI Key | VITACRBSQZBCDN-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | diphenylmethanes |
|---|
| Direct Parent | diphenylmethanes |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | amino acidsaromatic monoterpenoidsaryl chloridescarbonyl compoundscarboxylic acidsdichlorobenzeneshydrocarbon derivativesmonocarboxylic acids and derivativesmonocyclic monoterpenoidsorganic oxidesorganochloridesorganopnictogen compoundsphenylpropanoic acidstrialkylamines |
|---|
| Substituents | diphenylmethanemonoterpenoidcarbonyl groupmonocyclic monoterpenoidcarboxylic acidamino acid or derivativesamino acidorganochloridep-cymenecarboxylic acid derivativeorganohalogen compoundorganic oxide2-phenylpropanoic-acidorganonitrogen compoundorganopnictogen compound1,2-dichlorobenzenetertiary aminearyl chloridechlorobenzenetertiary aliphatic aminearyl halidearomatic homomonocyclic compoundmonocarboxylic acid or derivativesorganic oxygen compoundhydrocarbon derivativeorganic nitrogen compoundhalobenzeneamineorganooxygen compoundaromatic monoterpenoid |
|---|
