| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:53:44 UTC |
|---|
| Update Date | 2025-03-25 00:51:27 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02187048 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H13F3O3 |
|---|
| Molecular Mass | 226.0817 |
|---|
| SMILES | CC(C(=O)OC(C)(C)C)C(=O)C(F)(F)F |
|---|
| InChI Key | SYUGFNMRPFNBMS-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | keto acids and derivatives |
|---|
| Subclass | beta-keto acids and derivatives |
|---|
| Direct Parent | beta-keto acids and derivatives |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | 1,3-dicarbonyl compoundsalkyl fluoridesalpha-haloketonescarboxylic acid estersfatty acid estershydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganofluorides |
|---|
| Substituents | fatty acylaliphatic acyclic compoundcarbonyl groupalkyl fluorideorganofluoridecarboxylic acid derivativeorganohalogen compoundbeta-keto acidketonefatty acid esterorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundcarboxylic acid esteralpha-haloketonealkyl halidehydrocarbon derivative1,3-dicarbonyl compoundorganooxygen compound |
|---|