| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:53:45 UTC |
|---|
| Update Date | 2025-03-25 00:51:27 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02187061 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H13ClO3 |
|---|
| Molecular Mass | 288.0553 |
|---|
| SMILES | CC(C(=O)O)c1ccc(Cl)c(C(=O)c2ccccc2)c1 |
|---|
| InChI Key | URSYYZNMWCWNSE-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzophenones |
|---|
| Direct Parent | benzophenones |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | aryl chloridesaryl ketonesaryl-phenylketonesbenzoyl derivativescarboxylic acidschlorobenzenesdiphenylmethaneshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganochloridesphenylpropanoic acidsvinylogous halides |
|---|
| Substituents | diphenylmethanecarbonyl groupcarboxylic acidorganochloridebenzoylcarboxylic acid derivativeorganohalogen compoundbenzophenoneketoneorganic oxide2-phenylpropanoic-acidaryl chloridechlorobenzenearyl-phenylketonevinylogous halidearyl halidearomatic homomonocyclic compoundmonocarboxylic acid or derivativesorganic oxygen compoundhydrocarbon derivativehalobenzeneorganooxygen compoundaryl ketone |
|---|
