| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:53:48 UTC |
|---|
| Update Date | 2025-03-25 00:51:28 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02187182 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C21H24O10 |
|---|
| Molecular Mass | 436.1369 |
|---|
| SMILES | CC(C(=O)c1c(O)cc(O)cc1O)c1ccc(OC2OC(CO)C(O)C(O)C2O)cc1 |
|---|
| InChI Key | DISPCOFRPRGRQY-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | alpha-methyldeoxybenzoin flavonoids |
|---|
| Subclass | alpha-methyldeoxybenzoin flavonoids |
|---|
| Direct Parent | alpha-methyldeoxybenzoin flavonoids |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsacetalsacylphloroglucinols and derivativesalkyl-phenylketonesaryl alkyl ketonesbenzoyl derivativeshydrocarbon derivativesmonosaccharidesorganic oxidesoxacyclic compoundsoxanesphenol ethersphenoxy compoundsphenylpropanesprimary alcoholssecondary alcoholsstilbenesvinylogous acids |
|---|
| Substituents | phenol ethermonocyclic benzene moietyaryl alkyl ketonearomatic heteromonocyclic compoundbenzoyl1-hydroxy-2-unsubstituted benzenoidmonosaccharideketonephenylpropanephloroglucinol derivativesaccharideorganic oxideacetaloxaneprimary alcoholorganoheterocyclic compoundacylphloroglucinol derivativealcoholbenzenetriol1-hydroxy-4-unsubstituted benzenoidphenylketonealpha-methyldeoxybenzoin flavonoidoxacyclevinylogous acidorganic oxygen compoundsecondary alcoholphenolhydrocarbon derivativebenzenoidphenoxy compoundalkyl-phenylketoneorganooxygen compoundaryl ketonestilbene |
|---|