| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:53:49 UTC |
|---|
| Update Date | 2025-03-25 00:51:28 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02187245 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H18N3O7P |
|---|
| Molecular Mass | 347.0882 |
|---|
| SMILES | CC(=O)Nc1ccn(C2CC(O)C(COP(=O)(O)O)C2)c(=O)n1 |
|---|
| InChI Key | FUKZJRISHCTAIL-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | nucleosides, nucleotides, and analogues |
|---|
| Class | nucleoside and nucleotide analogues |
|---|
| Subclass | cyclopentyl nucleosides |
|---|
| Direct Parent | cyclopentyl nucleosides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetamidesazacyclic compoundscarbonyl compoundscarboxylic acids and derivativescyclic alcohols and derivativescyclopentanolsheteroaromatic compoundshydrocarbon derivativesimidolactamsmonoalkyl phosphatesn-acetylarylaminesorganic carbonic acids and derivativesorganic oxidesorganopnictogen compoundspyrimidonessecondary carboxylic acid amides |
|---|
| Substituents | carbonyl groupn-acetylarylaminearomatic heteromonocyclic compoundpyrimidonen-arylamidecarboxylic acid derivativepyrimidineorganic oxideorganonitrogen compoundorganopnictogen compoundimidolactamorganoheterocyclic compoundacetamidecyclopentyl nucleosidealcoholcarbonic acid derivativeazacycleheteroaromatic compoundcyclic alcoholcarboxamide groupcyclopentanolsecondary carboxylic acid amideorganic oxygen compoundphosphoric acid estermonoalkyl phosphatesecondary alcoholhydrocarbon derivativeorganic nitrogen compoundorganic phosphoric acid derivativealkyl phosphateorganooxygen compound |
|---|
